C25H20BrNO3 — CID 134960961
(Z,1R,2S)-2-(2-bromophenyl)-1-(4-nitrophenyl)-7-phenylhept-3-en-6-yn-1-ol (PubChem CID 134960961) has the molecular formula C25H20BrNO3 and a molecular weight of 462.34 g/mol. Its IUPAC name is (Z,1R,2S)-2-(2-bromophenyl)-1-(4-nitrophenyl)-7-phenylhept-3-en-6-yn-1-ol.
| Compound Name | (Z,1R,2S)-2-(2-bromophenyl)-1-(4-nitrophenyl)-7-phenylhept-3-en-6-yn-1-ol |
|---|---|
| PubChem CID | 134960961 |
| Molecular Formula | C25H20BrNO3 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | (Z,1R,2S)-2-(2-bromophenyl)-1-(4-nitrophenyl)-7-phenylhept-3-en-6-yn-1-ol |
| SMILES | O=[N+]([O-])c1ccc([C@H](O)[C@@H](/C=C\CC#Cc2ccccc2)c2ccccc2Br)cc1 |
| InChI | InChI=1S/C25H20BrNO3/c26-24-14-8-7-12-22(24)23(13-6-2-5-11-19-9-3-1-4-10-19)25(28)20-15-17-21(18-16-20)27(29)30/h1,3-4,6-10,12-18,23,25,28H,2H2/b13-6-/t23-,25-/m0/s1 |
| InChIKey | JRXYAQXBVOZWAC-PXGWGNCLSA-N |
| XLogP | 6.17 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|