C29H32N2O4S — CID 134961320
N-methyl-N-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-4-phenyl-1,3-oxazol-5-yl]methanesulfonamide (PubChem CID 134961320) has the molecular formula C29H32N2O4S and a molecular weight of 504.65 g/mol. Its IUPAC name is N-methyl-N-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-4-phenyl-1,3-oxazol-5-yl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-4-phenyl-1,3-oxazol-5-yl]methanesulfonamide |
|---|---|
| PubChem CID | 134961320 |
| Molecular Formula | C29H32N2O4S |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | N-methyl-N-[2-[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-4-phenyl-1,3-oxazol-5-yl]methanesulfonamide |
| SMILES | CN(c1oc(-c2ccc3c(c2)CC[C@@H]2[C@@H]3CC[C@]3(C)C(=O)CC[C@@H]23)nc1-c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C29H32N2O4S/c1-29-16-15-22-21-11-10-20(17-19(21)9-12-23(22)24(29)13-14-25(29)32)27-30-26(18-7-5-4-6-8-18)28(35-27)31(2)36(3,33)34/h4-8,10-11,17,22-24H,9,12-16H2,1-3H3/t22-,23-,24+,29+/m1/s1 |
| InChIKey | RIUNOGOKHITPKG-CHCBTGSZSA-N |
| XLogP | 5.83 |
| TPSA | 80.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |