C18H15NO2 — CID 134961819
4-[1-[(5S)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]ethenyl]benzaldehyde (PubChem CID 134961819) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-[1-[(5S)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]ethenyl]benzaldehyde.
| Compound Name | 4-[1-[(5S)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 134961819 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[1-[(5S)-2-phenyl-4,5-dihydro-1,3-oxazol-5-yl]ethenyl]benzaldehyde |
| SMILES | C=C(c1ccc(C=O)cc1)[C@H]1CN=C(c2ccccc2)O1 |
| InChI | InChI=1S/C18H15NO2/c1-13(15-9-7-14(12-20)8-10-15)17-11-19-18(21-17)16-5-3-2-4-6-16/h2-10,12,17H,1,11H2/t17-/m1/s1 |
| InChIKey | YHFKXEUOPYFLPZ-QGZVFWFLSA-N |
| XLogP | 3.36 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|