C28H29NO4 — CID 134961864
cyclohexyl (2R,3S)-2-hydroxy-5-oxo-2,3-diphenyl-5-pyridin-2-ylpentanoate (PubChem CID 134961864) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is cyclohexyl (2R,3S)-2-hydroxy-5-oxo-2,3-diphenyl-5-pyridin-2-ylpentanoate.
| Compound Name | cyclohexyl (2R,3S)-2-hydroxy-5-oxo-2,3-diphenyl-5-pyridin-2-ylpentanoate |
|---|---|
| PubChem CID | 134961864 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | cyclohexyl (2R,3S)-2-hydroxy-5-oxo-2,3-diphenyl-5-pyridin-2-ylpentanoate |
| SMILES | O=C(C[C@@H](c1ccccc1)[C@](O)(C(=O)OC1CCCCC1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C28H29NO4/c30-26(25-18-10-11-19-29-25)20-24(21-12-4-1-5-13-21)28(32,22-14-6-2-7-15-22)27(31)33-23-16-8-3-9-17-23/h1-2,4-7,10-15,18-19,23-24,32H,3,8-9,16-17,20H2/t24-,28-/m0/s1 |
| InChIKey | JIXONRYUNSHCKH-CUBQBAPOSA-N |
| XLogP | 5.20 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |