About 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole
1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole (PubChem CID 134962129) has the molecular formula C23H27N
and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole.
Molecular Properties
| Compound Name | 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole |
| PubChem CID | 134962129 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole |
| SMILES | CCCC[C@@](C)(/C=C/c1ccccc1)c1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C23H27N/c1-4-5-15-23(2,16-13-19-9-7-6-8-10-19)21-11-12-22-20(18-21)14-17-24(22)3/h6-14,16-18H,4-5,15H2,1-3H3/b16-13+/t23-/m0/s1 |
| InChIKey | SASRDZZYZOOBOR-IGVGMEOHSA-N |
| XLogP | 6.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole?
The IUPAC name of 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole (CID 134962129) is 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole.
What is the SMILES notation for 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole?
The canonical SMILES for 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole is CCCC[C@@](C)(/C=C/c1ccccc1)c1ccc2c(ccn2C)c1.
What is the InChIKey of 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole?
The InChIKey is SASRDZZYZOOBOR-IGVGMEOHSA-N. The full InChI is InChI=1S/C23H27N/c1-4-5-15-23(2,16-13-19-9-7-6-8-10-19)21-11-12-22-20(18-21)14-17-24(22)3/h6-14,16-18H,4-5,15H2,1-3H3/b16-13+/t23-/m0/s1.
What are the key properties of 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole?
1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole has a molecular weight of 317.48 g/mol, XLogP of 6.34, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole is sourced from PubChem (CID 134962129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).