C23H27N — CID 134962129
1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole (PubChem CID 134962129) has the molecular formula C23H27N and a molecular weight of 317.48 g/mol. Its IUPAC name is 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole.
| Compound Name | 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole |
|---|---|
| PubChem CID | 134962129 |
| Molecular Formula | C23H27N |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.21 |
| IUPAC Name | 1-methyl-5-[(E,3S)-3-methyl-1-phenylhept-1-en-3-yl]indole |
| SMILES | CCCC[C@@](C)(/C=C/c1ccccc1)c1ccc2c(ccn2C)c1 |
| InChI | InChI=1S/C23H27N/c1-4-5-15-23(2,16-13-19-9-7-6-8-10-19)21-11-12-22-20(18-21)14-17-24(22)3/h6-14,16-18H,4-5,15H2,1-3H3/b16-13+/t23-/m0/s1 |
| InChIKey | SASRDZZYZOOBOR-IGVGMEOHSA-N |
| XLogP | 6.34 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |