C39H35AuClN2-3 — CID 134962257
1,3-bis[(1R)-1-naphthalen-1-ylethyl]imidazolidin-2-ide;chlorogold;phenylbenzene (PubChem CID 134962257) has the molecular formula C39H35AuClN2-3 and a molecular weight of 764.14 g/mol. Its IUPAC name is 1,3-bis[(1R)-1-naphthalen-1-ylethyl]imidazolidin-2-ide;chlorogold;phenylbenzene.
| Compound Name | 1,3-bis[(1R)-1-naphthalen-1-ylethyl]imidazolidin-2-ide;chlorogold;phenylbenzene |
|---|---|
| PubChem CID | 134962257 |
| Molecular Formula | C39H35AuClN2-3 |
| Molecular Weight | 764.14 g/mol |
| Exact Mass | 763.22 |
| IUPAC Name | 1,3-bis[(1R)-1-naphthalen-1-ylethyl]imidazolidin-2-ide;chlorogold;phenylbenzene |
| SMILES | C[C@H](c1cccc2ccccc12)N1[CH-]N([C@H](C)c2cccc3ccccc23)CC1.Cl[Au].[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C27H27N2.C12H8.Au.ClH/c1-20(24-15-7-11-22-9-3-5-13-26(22)24)28-17-18-29(19-28)21(2)25-16-8-12-23-10-4-6-14-27(23)25;1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h3-16,19-21H,17-18H2,1-2H3;1-7,9H;;1H/q-1;-2;+1;/p-1/t20-,21-;;;/m1.../s1 |
| InChIKey | QCOYOMBUGQFWBX-AGEKDOICSA-M |
| XLogP | 10.19 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.14 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|