C17H15F4NOS — CID 134962275
(NE)-2-methyl-N-[[3-(2,3,5,6-tetrafluorophenyl)phenyl]methylidene]propane-2-sulfinamide (PubChem CID 134962275) has the molecular formula C17H15F4NOS and a molecular weight of 357.37 g/mol. Its IUPAC name is (NE)-2-methyl-N-[[3-(2,3,5,6-tetrafluorophenyl)phenyl]methylidene]propane-2-sulfinamide.
| Compound Name | (NE)-2-methyl-N-[[3-(2,3,5,6-tetrafluorophenyl)phenyl]methylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 134962275 |
| Molecular Formula | C17H15F4NOS |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (NE)-2-methyl-N-[[3-(2,3,5,6-tetrafluorophenyl)phenyl]methylidene]propane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)/N=C/c1cccc(-c2c(F)c(F)cc(F)c2F)c1 |
| InChI | InChI=1S/C17H15F4NOS/c1-17(2,3)24(23)22-9-10-5-4-6-11(7-10)14-15(20)12(18)8-13(19)16(14)21/h4-9H,1-3H3/b22-9+ |
| InChIKey | QUAMARAJJNTXTD-LSFURLLWSA-N |
| XLogP | 4.79 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|