C16H21F2NOS — CID 89158770
(NE,R)-N-[(2S)-2-(2,3-difluorophenyl)hex-5-enylidene]-2-methylpropane-2-sulfinamide (PubChem CID 89158770) has the molecular formula C16H21F2NOS and a molecular weight of 313.41 g/mol. Its IUPAC name is (NE,R)-N-[(2S)-2-(2,3-difluorophenyl)hex-5-enylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[(2S)-2-(2,3-difluorophenyl)hex-5-enylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 89158770 |
| Molecular Formula | C16H21F2NOS |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | (NE,R)-N-[(2S)-2-(2,3-difluorophenyl)hex-5-enylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C=CCC[C@H](/C=N/[S@](=O)C(C)(C)C)c1cccc(F)c1F |
| InChI | InChI=1S/C16H21F2NOS/c1-5-6-8-12(11-19-21(20)16(2,3)4)13-9-7-10-14(17)15(13)18/h5,7,9-12H,1,6,8H2,2-4H3/b19-11+/t12-,21-/m1/s1 |
| InChIKey | TZHIBZYWJWHCPY-KAYPFKLKSA-N |
| XLogP | 4.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|