C14H18F3NOS — CID 135077946
(NE,R)-2-methyl-N-(1,1,1-trifluoro-4-phenylbutan-2-ylidene)propane-2-sulfinamide (PubChem CID 135077946) has the molecular formula C14H18F3NOS and a molecular weight of 305.36 g/mol. Its IUPAC name is (NE,R)-2-methyl-N-(1,1,1-trifluoro-4-phenylbutan-2-ylidene)propane-2-sulfinamide.
| Compound Name | (NE,R)-2-methyl-N-(1,1,1-trifluoro-4-phenylbutan-2-ylidene)propane-2-sulfinamide |
|---|---|
| PubChem CID | 135077946 |
| Molecular Formula | C14H18F3NOS |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (NE,R)-2-methyl-N-(1,1,1-trifluoro-4-phenylbutan-2-ylidene)propane-2-sulfinamide |
| SMILES | CC(C)(C)[S@@](=O)/N=C(\CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NOS/c1-13(2,3)20(19)18-12(14(15,16)17)10-9-11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3/b18-12+/t20-/m1/s1 |
| InChIKey | KBQMRCFJSRKKPU-VOMPUTFMSA-N |
| XLogP | 4.08 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|