C22H30F3NOS — CID 164668628
tert-butyl-oxido-[(E)-[(2S)-2-prop-2-enyl-2-[[4-(trifluoromethyl)phenyl]methyl]cycloheptylidene]amino]sulfanium (PubChem CID 164668628) has the molecular formula C22H30F3NOS and a molecular weight of 413.55 g/mol. Its IUPAC name is tert-butyl-oxido-[(E)-[(2S)-2-prop-2-enyl-2-[[4-(trifluoromethyl)phenyl]methyl]cycloheptylidene]amino]sulfanium.
| Compound Name | tert-butyl-oxido-[(E)-[(2S)-2-prop-2-enyl-2-[[4-(trifluoromethyl)phenyl]methyl]cycloheptylidene]amino]sulfanium |
|---|---|
| PubChem CID | 164668628 |
| Molecular Formula | C22H30F3NOS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | tert-butyl-oxido-[(E)-[(2S)-2-prop-2-enyl-2-[[4-(trifluoromethyl)phenyl]methyl]cycloheptylidene]amino]sulfanium |
| SMILES | C=CC[C@]1(Cc2ccc(C(F)(F)F)cc2)CCCCC/C1=N\[S+]([O-])C(C)(C)C |
| InChI | InChI=1S/C22H30F3NOS/c1-5-14-21(16-17-10-12-18(13-11-17)22(23,24)25)15-8-6-7-9-19(21)26-28(27)20(2,3)4/h5,10-13H,1,6-9,14-16H2,2-4H3/b26-19+/t21-,28?/m1/s1 |
| InChIKey | HOILVTYWFDHOGK-MSEQIOGRSA-N |
| XLogP | 6.68 |
| TPSA | 35.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|