C14H20FNOS — CID 118278047
(NE,R)-N-[4-(4-fluorophenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 118278047) has the molecular formula C14H20FNOS and a molecular weight of 269.38 g/mol. Its IUPAC name is (NE,R)-N-[4-(4-fluorophenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide.
| Compound Name | (NE,R)-N-[4-(4-fluorophenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 118278047 |
| Molecular Formula | C14H20FNOS |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | (NE,R)-N-[4-(4-fluorophenyl)butan-2-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(CCc1ccc(F)cc1)=N\[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C14H20FNOS/c1-11(16-18(17)14(2,3)4)5-6-12-7-9-13(15)10-8-12/h7-10H,5-6H2,1-4H3/b16-11+/t18-/m1/s1 |
| InChIKey | RUJMARYIVWZFGU-QIPHDZALSA-N |
| XLogP | 3.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|