C19H20F3NOS — CID 88572627
(NE,S)-2-methyl-N-[1-[3-[4-(trifluoromethyl)phenyl]phenyl]ethylidene]propane-2-sulfinamide (PubChem CID 88572627) has the molecular formula C19H20F3NOS and a molecular weight of 367.44 g/mol. Its IUPAC name is (NE,S)-2-methyl-N-[1-[3-[4-(trifluoromethyl)phenyl]phenyl]ethylidene]propane-2-sulfinamide.
| Compound Name | (NE,S)-2-methyl-N-[1-[3-[4-(trifluoromethyl)phenyl]phenyl]ethylidene]propane-2-sulfinamide |
|---|---|
| PubChem CID | 88572627 |
| Molecular Formula | C19H20F3NOS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (NE,S)-2-methyl-N-[1-[3-[4-(trifluoromethyl)phenyl]phenyl]ethylidene]propane-2-sulfinamide |
| SMILES | C/C(=N\[S@@](=O)C(C)(C)C)c1cccc(-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H20F3NOS/c1-13(23-25(24)18(2,3)4)15-6-5-7-16(12-15)14-8-10-17(11-9-14)19(20,21)22/h5-12H,1-4H3/b23-13+/t25-/m0/s1 |
| InChIKey | VWAWZMCCUHHQCO-ITIZVALFSA-N |
| XLogP | 5.64 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|