C21H31NO6 — CID 134962338
tert-butyl (3aR,6R,6aR)-3a-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 134962338) has the molecular formula C21H31NO6 and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl (3aR,6R,6aR)-3a-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aR,6R,6aR)-3a-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 134962338 |
| Molecular Formula | C21H31NO6 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | tert-butyl (3aR,6R,6aR)-3a-(hydroxymethyl)-2,2-dimethyl-6-(phenylmethoxymethyl)-6,6a-dihydro-4H-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@]2(CO)OC(C)(C)O[C@@H]2[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C21H31NO6/c1-19(2,3)27-18(24)22-13-21(14-23)17(26-20(4,5)28-21)16(22)12-25-11-15-9-7-6-8-10-15/h6-10,16-17,23H,11-14H2,1-5H3/t16-,17-,21-/m1/s1 |
| InChIKey | XKTIMFRPXUTRDO-CBGDNZLLSA-N |
| XLogP | 2.71 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |