C17H33NSi — CID 134964214
trimethyl-[2-[[(2S)-6-pentyl-2,3,4,5-tetrahydropyridin-2-yl]methyl]prop-2-enyl]silane (PubChem CID 134964214) has the molecular formula C17H33NSi and a molecular weight of 279.54 g/mol. Its IUPAC name is trimethyl-[2-[[(2S)-6-pentyl-2,3,4,5-tetrahydropyridin-2-yl]methyl]prop-2-enyl]silane.
| Compound Name | trimethyl-[2-[[(2S)-6-pentyl-2,3,4,5-tetrahydropyridin-2-yl]methyl]prop-2-enyl]silane |
|---|---|
| PubChem CID | 134964214 |
| Molecular Formula | C17H33NSi |
| Molecular Weight | 279.54 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | trimethyl-[2-[[(2S)-6-pentyl-2,3,4,5-tetrahydropyridin-2-yl]methyl]prop-2-enyl]silane |
| SMILES | C=C(C[C@@H]1CCCC(CCCCC)=N1)C[Si](C)(C)C |
| InChI | InChI=1S/C17H33NSi/c1-6-7-8-10-16-11-9-12-17(18-16)13-15(2)14-19(3,4)5/h17H,2,6-14H2,1,3-5H3/t17-/m0/s1 |
| InChIKey | FIKMXGJANDVRLD-KRWDZBQOSA-N |
| XLogP | 5.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|