C11H17NO — CID 134965168
10,10-dimethyl-4-azatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 134965168) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 10,10-dimethyl-4-azatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | 10,10-dimethyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 134965168 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 10,10-dimethyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | CC1(C)C2CCC1C1C(=O)NCC12 |
| InChI | InChI=1S/C11H17NO/c1-11(2)7-3-4-8(11)9-6(7)5-12-10(9)13/h6-9H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | HTSDSKPQDNLVJS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |