C11H13NO — CID 130019616
10-ethynyl-4-azatricyclo[5.2.1.02,6]decan-3-one (PubChem CID 130019616) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 10-ethynyl-4-azatricyclo[5.2.1.02,6]decan-3-one.
| Compound Name | 10-ethynyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
|---|---|
| PubChem CID | 130019616 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 10-ethynyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
| SMILES | C#CC1C2CCC1C1C(=O)NCC21 |
| InChI | InChI=1S/C11H13NO/c1-2-6-7-3-4-8(6)10-9(7)5-12-11(10)13/h1,6-10H,3-5H2,(H,12,13) |
| InChIKey | KSZAMVYDMJRWMU-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|