About spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one
spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one (PubChem CID 54312281) has the molecular formula C10H15NO
and a molecular weight of 165.24 g/mol. Its IUPAC name is spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one.
Analyze spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one?
The IUPAC name of spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one (CID 54312281) is spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one.
What is the SMILES notation for spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one?
The canonical SMILES for spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one is O=C1CC2(CN1)CC1CCC2C1.
What is the InChIKey of spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one?
The InChIKey is SLSJYLZJHCQKSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO/c12-9-5-10(6-11-9)4-7-1-2-8(10)3-7/h7-8H,1-6H2,(H,11,12).
What are the key properties of spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one?
spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one has a molecular weight of 165.24 g/mol, XLogP of 1.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[2.2.1]heptane-2,4'-pyrrolidine]-2'-one is sourced from PubChem (CID 54312281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).