C9H14S — CID 134965301
4-ethenyl-3-ethyl-3,6-dihydro-2H-thiopyran (PubChem CID 134965301) has the molecular formula C9H14S and a molecular weight of 154.28 g/mol. Its IUPAC name is 4-ethenyl-3-ethyl-3,6-dihydro-2H-thiopyran.
| Compound Name | 4-ethenyl-3-ethyl-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 134965301 |
| Molecular Formula | C9H14S |
| Molecular Weight | 154.28 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 4-ethenyl-3-ethyl-3,6-dihydro-2H-thiopyran |
| SMILES | C=CC1=CCSCC1CC |
| InChI | InChI=1S/C9H14S/c1-3-8-5-6-10-7-9(8)4-2/h3,5,9H,1,4,6-7H2,2H3 |
| InChIKey | VVJTVGAZDJLVIL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.28 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |