C14H20O4 — CID 134965942
methyl 3-[(3aR,6R,7aS)-6-methyl-2,4-dioxo-1,3,5,6,7,7a-hexahydroinden-3a-yl]propanoate (PubChem CID 134965942) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl 3-[(3aR,6R,7aS)-6-methyl-2,4-dioxo-1,3,5,6,7,7a-hexahydroinden-3a-yl]propanoate.
| Compound Name | methyl 3-[(3aR,6R,7aS)-6-methyl-2,4-dioxo-1,3,5,6,7,7a-hexahydroinden-3a-yl]propanoate |
|---|---|
| PubChem CID | 134965942 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl 3-[(3aR,6R,7aS)-6-methyl-2,4-dioxo-1,3,5,6,7,7a-hexahydroinden-3a-yl]propanoate |
| SMILES | COC(=O)CC[C@@]12CC(=O)C[C@@H]1C[C@@H](C)CC2=O |
| InChI | InChI=1S/C14H20O4/c1-9-5-10-7-11(15)8-14(10,12(16)6-9)4-3-13(17)18-2/h9-10H,3-8H2,1-2H3/t9-,10+,14-/m1/s1 |
| InChIKey | FUAUSKSYNHMBNU-ISTVAULSSA-N |
| XLogP | 1.90 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |