C13H14O2 — CID 134966242
(1R,4R,12R)-1,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one (PubChem CID 134966242) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1R,4R,12R)-1,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one.
| Compound Name | (1R,4R,12R)-1,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one |
|---|---|
| PubChem CID | 134966242 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1R,4R,12R)-1,11-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one |
| SMILES | CC1=CC(=O)C2=CC=C[C@H]3CO[C@]1(C)[C@@H]23 |
| InChI | InChI=1S/C13H14O2/c1-8-6-11(14)10-5-3-4-9-7-15-13(8,2)12(9)10/h3-6,9,12H,7H2,1-2H3/t9-,12+,13-/m0/s1 |
| InChIKey | AAFHZWJSGQSQLW-BIMULSAOSA-N |
| XLogP | 2.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |