C22H34O3Si — CID 135026987
(1S,4R,12R)-1-[2-tri(propan-2-yl)silyloxyethyl]-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one (PubChem CID 135026987) has the molecular formula C22H34O3Si and a molecular weight of 374.60 g/mol. Its IUPAC name is (1S,4R,12R)-1-[2-tri(propan-2-yl)silyloxyethyl]-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one.
| Compound Name | (1S,4R,12R)-1-[2-tri(propan-2-yl)silyloxyethyl]-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one |
|---|---|
| PubChem CID | 135026987 |
| Molecular Formula | C22H34O3Si |
| Molecular Weight | 374.60 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | (1S,4R,12R)-1-[2-tri(propan-2-yl)silyloxyethyl]-2-oxatricyclo[6.3.1.04,12]dodeca-5,7,10-trien-9-one |
| SMILES | CC(C)[Si](OCC[C@@]12C=CC(=O)C3=CC=C[C@@H](CO1)[C@H]32)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H34O3Si/c1-15(2)26(16(3)4,17(5)6)25-13-12-22-11-10-20(23)19-9-7-8-18(14-24-22)21(19)22/h7-11,15-18,21H,12-14H2,1-6H3/t18-,21+,22+/m0/s1 |
| InChIKey | XBBBFUBXSMSVSO-VLCRHTCISA-N |
| XLogP | 5.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|