C17H22O2 — CID 154716700
(1S,8R,12S)-6,7-diethyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one (PubChem CID 154716700) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S,8R,12S)-6,7-diethyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one.
| Compound Name | (1S,8R,12S)-6,7-diethyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
|---|---|
| PubChem CID | 154716700 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (1S,8R,12S)-6,7-diethyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
| SMILES | CCC1=C(CC)[C@@H]2C(=O)C=C[C@]3(C)OCC(=C1C)[C@H]23 |
| InChI | InChI=1S/C17H22O2/c1-5-11-10(3)13-9-19-17(4)8-7-14(18)15(16(13)17)12(11)6-2/h7-8,15-16H,5-6,9H2,1-4H3/t15-,16-,17+/m1/s1 |
| InChIKey | BCKYQKQENZERNJ-ZACQAIPSSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |