C16H18O2 — CID 154716699
(1S,8S,12S)-6-cyclopropyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one (PubChem CID 154716699) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is (1S,8S,12S)-6-cyclopropyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one.
| Compound Name | (1S,8S,12S)-6-cyclopropyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
|---|---|
| PubChem CID | 154716699 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (1S,8S,12S)-6-cyclopropyl-1,5-dimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
| SMILES | CC1=C2CO[C@@]3(C)C=CC(=O)[C@@H](C=C1C1CC1)[C@@H]23 |
| InChI | InChI=1S/C16H18O2/c1-9-11(10-3-4-10)7-12-14(17)5-6-16(2)15(12)13(9)8-18-16/h5-7,10,12,15H,3-4,8H2,1-2H3/t12-,15+,16+/m1/s1 |
| InChIKey | PKALTBMVXDDMSY-KCXAZCMYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |