C14H16O2 — CID 154716698
(1S,8R,12S)-1,5,7-trimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one (PubChem CID 154716698) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S,8R,12S)-1,5,7-trimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one.
| Compound Name | (1S,8R,12S)-1,5,7-trimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
|---|---|
| PubChem CID | 154716698 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | (1S,8R,12S)-1,5,7-trimethyl-2-oxatricyclo[6.3.1.04,12]dodeca-4,6,10-trien-9-one |
| SMILES | CC1=CC(C)=C2CO[C@@]3(C)C=CC(=O)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C14H16O2/c1-8-6-9(2)12-11(15)4-5-14(3)13(12)10(8)7-16-14/h4-6,12-13H,7H2,1-3H3/t12-,13-,14+/m1/s1 |
| InChIKey | SYINYXGMKMISGR-MCIONIFRSA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |