C11H12O3Rh — CID 134966673
[(3Z)-4-[(3S)-4-methanidylideneoxolan-3-yl]buta-1,3-dien-2-yl] acetate;rhodium(2+) (PubChem CID 134966673) has the molecular formula C11H12O3Rh and a molecular weight of 295.12 g/mol. Its IUPAC name is [(3Z)-4-[(3S)-4-methanidylideneoxolan-3-yl]buta-1,3-dien-2-yl] acetate;rhodium(2+).
| Compound Name | [(3Z)-4-[(3S)-4-methanidylideneoxolan-3-yl]buta-1,3-dien-2-yl] acetate;rhodium(2+) |
|---|---|
| PubChem CID | 134966673 |
| Molecular Formula | C11H12O3Rh |
| Molecular Weight | 295.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | [(3Z)-4-[(3S)-4-methanidylideneoxolan-3-yl]buta-1,3-dien-2-yl] acetate;rhodium(2+) |
| SMILES | [H]/[C-]=C(/C=C\[C@@H]1COC/C1=[C-]\[H])OC(C)=O.[Rh+2] |
| InChI | InChI=1S/C11H12O3.Rh/c1-8-6-13-7-11(8)5-4-9(2)14-10(3)12;/h1-2,4-5,11H,6-7H2,3H3;/q-2;+2/b5-4-;/t11-;/m1./s1 |
| InChIKey | DXWUGKKNOBQDFL-WVAUSALQSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.12 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|