C10H14O2 — CID 143144669
(3-methylcyclohexa-1,5-dien-1-yl)methyl acetate (PubChem CID 143144669) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (3-methylcyclohexa-1,5-dien-1-yl)methyl acetate.
| Compound Name | (3-methylcyclohexa-1,5-dien-1-yl)methyl acetate |
|---|---|
| PubChem CID | 143144669 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (3-methylcyclohexa-1,5-dien-1-yl)methyl acetate |
| SMILES | CC(=O)OCC1=CC(C)CC=C1 |
| InChI | InChI=1S/C10H14O2/c1-8-4-3-5-10(6-8)7-12-9(2)11/h3,5-6,8H,4,7H2,1-2H3 |
| InChIKey | INZNERBMHDSLEF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |