C9H18O2Si — CID 13496740
(5-methyl-3-trimethylsilyl-2,5-dihydrofuran-2-yl)methanol (PubChem CID 13496740) has the molecular formula C9H18O2Si and a molecular weight of 186.33 g/mol. Its IUPAC name is (5-methyl-3-trimethylsilyl-2,5-dihydrofuran-2-yl)methanol.
| Compound Name | (5-methyl-3-trimethylsilyl-2,5-dihydrofuran-2-yl)methanol |
|---|---|
| PubChem CID | 13496740 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (5-methyl-3-trimethylsilyl-2,5-dihydrofuran-2-yl)methanol |
| SMILES | CC1C=C([Si](C)(C)C)C(CO)O1 |
| InChI | InChI=1S/C9H18O2Si/c1-7-5-9(12(2,3)4)8(6-10)11-7/h5,7-8,10H,6H2,1-4H3 |
| InChIKey | RHMWINLOEUHOPU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|