C10H16O2Si — CID 141311880
[(5R)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methanol (PubChem CID 141311880) has the molecular formula C10H16O2Si and a molecular weight of 196.32 g/mol. Its IUPAC name is [(5R)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methanol.
| Compound Name | [(5R)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methanol |
|---|---|
| PubChem CID | 141311880 |
| Molecular Formula | C10H16O2Si |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | [(5R)-5-(2-trimethylsilylethynyl)-2H-furan-5-yl]methanol |
| SMILES | C[Si](C)(C)C#C[C@@]1(CO)C=CCO1 |
| InChI | InChI=1S/C10H16O2Si/c1-13(2,3)8-6-10(9-11)5-4-7-12-10/h4-5,11H,7,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | ZKEFZVVCBZHDQC-SNVBAGLBSA-N |
| XLogP | 1.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|