C13H18O2 — CID 134967604
(1S)-1-(2-methylpropyl)-3,4-dihydro-1H-isochromen-6-ol (PubChem CID 134967604) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1S)-1-(2-methylpropyl)-3,4-dihydro-1H-isochromen-6-ol.
| Compound Name | (1S)-1-(2-methylpropyl)-3,4-dihydro-1H-isochromen-6-ol |
|---|---|
| PubChem CID | 134967604 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1S)-1-(2-methylpropyl)-3,4-dihydro-1H-isochromen-6-ol |
| SMILES | CC(C)C[C@@H]1OCCc2cc(O)ccc21 |
| InChI | InChI=1S/C13H18O2/c1-9(2)7-13-12-4-3-11(14)8-10(12)5-6-15-13/h3-4,8-9,13-14H,5-7H2,1-2H3/t13-/m0/s1 |
| InChIKey | RUPGTHRFQCODDJ-ZDUSSCGKSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |