C13H22O2 — CID 134968109
(5R,6S)-6-hydroxy-2-methyl-5-propan-2-ylnona-2,8-dien-4-one (PubChem CID 134968109) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (5R,6S)-6-hydroxy-2-methyl-5-propan-2-ylnona-2,8-dien-4-one.
| Compound Name | (5R,6S)-6-hydroxy-2-methyl-5-propan-2-ylnona-2,8-dien-4-one |
|---|---|
| PubChem CID | 134968109 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (5R,6S)-6-hydroxy-2-methyl-5-propan-2-ylnona-2,8-dien-4-one |
| SMILES | C=CC[C@H](O)[C@H](C(=O)C=C(C)C)C(C)C |
| InChI | InChI=1S/C13H22O2/c1-6-7-11(14)13(10(4)5)12(15)8-9(2)3/h6,8,10-11,13-14H,1,7H2,2-5H3/t11-,13+/m0/s1 |
| InChIKey | OMNUJKDFGLCSJH-WCQYABFASA-N |
| XLogP | 2.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|