C13H17F3O3S — CID 134968803
(4-butyl-3,5-dimethylphenyl) trifluoromethanesulfonate (PubChem CID 134968803) has the molecular formula C13H17F3O3S and a molecular weight of 310.34 g/mol. Its IUPAC name is (4-butyl-3,5-dimethylphenyl) trifluoromethanesulfonate.
| Compound Name | (4-butyl-3,5-dimethylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134968803 |
| Molecular Formula | C13H17F3O3S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (4-butyl-3,5-dimethylphenyl) trifluoromethanesulfonate |
| SMILES | CCCCc1c(C)cc(OS(=O)(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H17F3O3S/c1-4-5-6-12-9(2)7-11(8-10(12)3)19-20(17,18)13(14,15)16/h7-8H,4-6H2,1-3H3 |
| InChIKey | ZGINPJYMVSIRQO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|