C16H18FN — CID 134969110
(4aR)-6-fluoro-4a-(2-methylprop-2-enyl)-1,2,3,4-tetrahydrocarbazole (PubChem CID 134969110) has the molecular formula C16H18FN and a molecular weight of 243.32 g/mol. Its IUPAC name is (4aR)-6-fluoro-4a-(2-methylprop-2-enyl)-1,2,3,4-tetrahydrocarbazole.
| Compound Name | (4aR)-6-fluoro-4a-(2-methylprop-2-enyl)-1,2,3,4-tetrahydrocarbazole |
|---|---|
| PubChem CID | 134969110 |
| Molecular Formula | C16H18FN |
| Molecular Weight | 243.32 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (4aR)-6-fluoro-4a-(2-methylprop-2-enyl)-1,2,3,4-tetrahydrocarbazole |
| SMILES | C=C(C)C[C@@]12CCCCC1=Nc1ccc(F)cc12 |
| InChI | InChI=1S/C16H18FN/c1-11(2)10-16-8-4-3-5-15(16)18-14-7-6-12(17)9-13(14)16/h6-7,9H,1,3-5,8,10H2,2H3/t16-/m1/s1 |
| InChIKey | YBDXXXLUFSRNHO-MRXNPFEDSA-N |
| XLogP | 4.69 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|