C25H29NO6 — CID 134969583
benzyl (3aS,6R)-6-formyl-2,2,4-trimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate (PubChem CID 134969583) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is benzyl (3aS,6R)-6-formyl-2,2,4-trimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate.
| Compound Name | benzyl (3aS,6R)-6-formyl-2,2,4-trimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 134969583 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | benzyl (3aS,6R)-6-formyl-2,2,4-trimethyl-7-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridine-5-carboxylate |
| SMILES | CC1[C@@H]2OC(C)(C)OC2C(OCc2ccccc2)[C@H](C=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H29NO6/c1-17-21-23(32-25(2,3)31-21)22(29-15-18-10-6-4-7-11-18)20(14-27)26(17)24(28)30-16-19-12-8-5-9-13-19/h4-14,17,20-23H,15-16H2,1-3H3/t17?,20-,21-,22?,23?/m0/s1 |
| InChIKey | HOZACIAHJPFKTH-NMDFIUOASA-N |
| XLogP | 3.70 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|