C26H35NO8 — CID 134969789
tert-butyl (4R)-4-[hydroxy-[(2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-4-yl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 134969789) has the molecular formula C26H35NO8 and a molecular weight of 489.57 g/mol. Its IUPAC name is tert-butyl (4R)-4-[hydroxy-[(2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-4-yl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (4R)-4-[hydroxy-[(2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-4-yl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 134969789 |
| Molecular Formula | C26H35NO8 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | tert-butyl (4R)-4-[hydroxy-[(2S,5R)-2-phenylmethoxy-6,8-dioxabicyclo[3.2.1]oct-3-en-4-yl]methyl]-2,2-dimethyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2OC(C)(C)OC2[C@H]1C(O)C1=C[C@H](OCc2ccccc2)C2CO[C@@H]1O2 |
| InChI | InChI=1S/C26H35NO8/c1-25(2,3)35-24(29)27-12-18-22(34-26(4,5)33-18)20(27)21(28)16-11-17(19-14-31-23(16)32-19)30-13-15-9-7-6-8-10-15/h6-11,17-23,28H,12-14H2,1-5H3/t17-,18?,19?,20+,21?,22?,23+/m0/s1 |
| InChIKey | IHTNZUADROPCRC-FRGHOBLPSA-N |
| XLogP | 2.75 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|