C21H24O7S2 — CID 134969910
[5-[(E)-2-(benzenesulfonyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134969910) has the molecular formula C21H24O7S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is [5-[(E)-2-(benzenesulfonyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [5-[(E)-2-(benzenesulfonyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134969910 |
| Molecular Formula | C21H24O7S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | [5-[(E)-2-(benzenesulfonyl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2OC(C)(C)OC2/C=C/S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H24O7S2/c1-16-9-11-18(12-10-16)30(24,25)26-15-20-19(27-21(2,3)28-20)13-14-29(22,23)17-7-5-4-6-8-17/h4-14,19-20H,15H2,1-3H3/b14-13+ |
| InChIKey | QNXRYJKWYABKQQ-BUHFOSPRSA-N |
| XLogP | 3.21 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|