C16H21IO4S2 — CID 10928767
(4R,5R)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonyl-2-methylsulfanylethenyl]-1,3-dioxolane (PubChem CID 10928767) has the molecular formula C16H21IO4S2 and a molecular weight of 468.38 g/mol. Its IUPAC name is (4R,5R)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonyl-2-methylsulfanylethenyl]-1,3-dioxolane.
| Compound Name | (4R,5R)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonyl-2-methylsulfanylethenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10928767 |
| Molecular Formula | C16H21IO4S2 |
| Molecular Weight | 468.38 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | (4R,5R)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonyl-2-methylsulfanylethenyl]-1,3-dioxolane |
| SMILES | CS/C(=C\[C@H]1OC(C)(C)O[C@H]1CI)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H21IO4S2/c1-11-5-7-12(8-6-11)23(18,19)15(22-4)9-13-14(10-17)21-16(2,3)20-13/h5-9,13-14H,10H2,1-4H3/b15-9+/t13-,14+/m1/s1 |
| InChIKey | XNRHKUSTILXICF-PWCXKOHKSA-N |
| XLogP | 3.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|