C26H28NO5P — CID 134970009
N-diphenylphosphoryl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-amine (PubChem CID 134970009) has the molecular formula C26H28NO5P and a molecular weight of 465.49 g/mol. Its IUPAC name is N-diphenylphosphoryl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-amine.
| Compound Name | N-diphenylphosphoryl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-amine |
|---|---|
| PubChem CID | 134970009 |
| Molecular Formula | C26H28NO5P |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | N-diphenylphosphoryl-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-amine |
| SMILES | COC1CC(NP(=O)(c2ccccc2)c2ccccc2)C2OC(c3ccccc3)OCC2O1 |
| InChI | InChI=1S/C26H28NO5P/c1-29-24-17-22(25-23(31-24)18-30-26(32-25)19-11-5-2-6-12-19)27-33(28,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-26H,17-18H2,1H3,(H,27,28) |
| InChIKey | PQFADRUYOPYHTM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|