C34H38ClNO5 — CID 162737026
(3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine;hydrochloride (PubChem CID 162737026) has the molecular formula C34H38ClNO5 and a molecular weight of 576.13 g/mol. Its IUPAC name is (3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine;hydrochloride.
| Compound Name | (3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 162737026 |
| Molecular Formula | C34H38ClNO5 |
| Molecular Weight | 576.13 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (3R,4R,5S,6R)-2,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-amine;hydrochloride |
| SMILES | Cl.N[C@H]1C(OCc2ccccc2)O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H37NO5.ClH/c35-31-33(38-23-28-17-9-3-10-18-28)32(37-22-27-15-7-2-8-16-27)30(25-36-21-26-13-5-1-6-14-26)40-34(31)39-24-29-19-11-4-12-20-29;/h1-20,30-34H,21-25,35H2;1H/t30-,31-,32-,33-,34?;/m1./s1 |
| InChIKey | RLOBEPJQZFGAPX-XTNXPORCSA-N |
| XLogP | 6.06 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.13 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |