C15H19NO2S — CID 134970072
1-[(3R)-3-benzylsulfanylbutanoyl]pyrrolidin-2-one (PubChem CID 134970072) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 1-[(3R)-3-benzylsulfanylbutanoyl]pyrrolidin-2-one.
| Compound Name | 1-[(3R)-3-benzylsulfanylbutanoyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 134970072 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[(3R)-3-benzylsulfanylbutanoyl]pyrrolidin-2-one |
| SMILES | C[C@H](CC(=O)N1CCCC1=O)SCc1ccccc1 |
| InChI | InChI=1S/C15H19NO2S/c1-12(19-11-13-6-3-2-4-7-13)10-15(18)16-9-5-8-14(16)17/h2-4,6-7,12H,5,8-11H2,1H3/t12-/m1/s1 |
| InChIKey | NQKKWVYYGZMGPQ-GFCCVEGCSA-N |
| XLogP | 2.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |