C31H40N4O4Si — CID 134970996
(E)-N-[[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methylcarbamoyl]-3-ethoxyprop-2-enamide (PubChem CID 134970996) has the molecular formula C31H40N4O4Si and a molecular weight of 560.77 g/mol. Its IUPAC name is (E)-N-[[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methylcarbamoyl]-3-ethoxyprop-2-enamide.
| Compound Name | (E)-N-[[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methylcarbamoyl]-3-ethoxyprop-2-enamide |
|---|---|
| PubChem CID | 134970996 |
| Molecular Formula | C31H40N4O4Si |
| Molecular Weight | 560.77 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | (E)-N-[[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methylcarbamoyl]-3-ethoxyprop-2-enamide |
| SMILES | CCO/C=C/C(=O)NC(=O)NC[C@@H]1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c2c1cnn2C |
| InChI | InChI=1S/C31H40N4O4Si/c1-6-38-18-17-28(36)34-30(37)32-20-23-19-24(29-27(23)21-33-35(29)5)22-39-40(31(2,3)4,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-18,21,23-24H,6,19-20,22H2,1-5H3,(H2,32,34,36,37)/b18-17+/t23-,24+/m0/s1 |
| InChIKey | KSNXZALSZXJKIZ-HEFFAWAOSA-N |
| XLogP | 3.94 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.77 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|