C25H31N5OSi — CID 134970994
[(4R,6S)-4-(azidomethyl)-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 134970994) has the molecular formula C25H31N5OSi and a molecular weight of 445.64 g/mol. Its IUPAC name is [(4R,6S)-4-(azidomethyl)-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(4R,6S)-4-(azidomethyl)-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 134970994 |
| Molecular Formula | C25H31N5OSi |
| Molecular Weight | 445.64 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [(4R,6S)-4-(azidomethyl)-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | Cn1ncc2c1[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H]2CN=[N+]=[N-] |
| InChI | InChI=1S/C25H31N5OSi/c1-25(2,3)32(21-11-7-5-8-12-21,22-13-9-6-10-14-22)31-18-20-15-19(16-27-29-26)23-17-28-30(4)24(20)23/h5-14,17,19-20H,15-16,18H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | NRFFDGCFULBDNL-VQTJNVASSA-N |
| XLogP | 4.88 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|