C31H36N2O2Si — CID 134969927
[(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol (PubChem CID 134969927) has the molecular formula C31H36N2O2Si and a molecular weight of 496.73 g/mol. Its IUPAC name is [(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol.
| Compound Name | [(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol |
|---|---|
| PubChem CID | 134969927 |
| Molecular Formula | C31H36N2O2Si |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@@H](CO)c2cn(Cc3ccccc3)nc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O2Si/c1-31(2,3)36(27-15-9-5-10-16-27,28-17-11-6-12-18-28)35-23-26-19-25(22-34)29-21-33(32-30(26)29)20-24-13-7-4-8-14-24/h4-18,21,25-26,34H,19-20,22-23H2,1-3H3/t25-,26+/m0/s1 |
| InChIKey | DXTDEVJUNTUFSY-IZZNHLLZSA-N |
| XLogP | 5.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|