C25H32N2O2Si — CID 134973457
[(4S,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methanol (PubChem CID 134973457) has the molecular formula C25H32N2O2Si and a molecular weight of 420.63 g/mol. Its IUPAC name is [(4S,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methanol.
| Compound Name | [(4S,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methanol |
|---|---|
| PubChem CID | 134973457 |
| Molecular Formula | C25H32N2O2Si |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | [(4S,6R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-6-yl]methanol |
| SMILES | Cn1ncc2c1[C@H](CO)C[C@@H]2CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H32N2O2Si/c1-25(2,3)30(21-11-7-5-8-12-21,22-13-9-6-10-14-22)29-18-20-15-19(17-28)24-23(20)16-26-27(24)4/h5-14,16,19-20,28H,15,17-18H2,1-4H3/t19-,20+/m0/s1 |
| InChIKey | NRKYCOFEPHHEBJ-VQTJNVASSA-N |
| XLogP | 3.56 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|