C26H34N2O4SSi — CID 101387633
[(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methyl methanesulfonate (PubChem CID 101387633) has the molecular formula C26H34N2O4SSi and a molecular weight of 498.72 g/mol. Its IUPAC name is [(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methyl methanesulfonate.
| Compound Name | [(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 101387633 |
| Molecular Formula | C26H34N2O4SSi |
| Molecular Weight | 498.72 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | [(4R,6S)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methyl methanesulfonate |
| SMILES | Cn1ncc2c1[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H]2COS(C)(=O)=O |
| InChI | InChI=1S/C26H34N2O4SSi/c1-26(2,3)34(22-12-8-6-9-13-22,23-14-10-7-11-15-23)32-19-21-16-20(18-31-33(5,29)30)24-17-27-28(4)25(21)24/h6-15,17,20-21H,16,18-19H2,1-5H3/t20-,21+/m0/s1 |
| InChIKey | VGERZEPTXCMSEO-LEWJYISDSA-N |
| XLogP | 3.54 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|