C32H38N2O4SSi — CID 102511472
[(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methyl methanesulfonate (PubChem CID 102511472) has the molecular formula C32H38N2O4SSi and a molecular weight of 574.82 g/mol. Its IUPAC name is [(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methyl methanesulfonate.
| Compound Name | [(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 102511472 |
| Molecular Formula | C32H38N2O4SSi |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | [(4R,6S)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-5,6-dihydro-4H-cyclopenta[c]pyrazol-4-yl]methyl methanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@@H](COS(C)(=O)=O)c2cn(Cc3ccccc3)nc21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H38N2O4SSi/c1-32(2,3)40(28-16-10-6-11-17-28,29-18-12-7-13-19-29)38-24-27-20-26(23-37-39(4,35)36)30-22-34(33-31(27)30)21-25-14-8-5-9-15-25/h5-19,22,26-27H,20-21,23-24H2,1-4H3/t26-,27+/m0/s1 |
| InChIKey | VYHMIMPIUTXWCR-RRPNLBNLSA-N |
| XLogP | 5.06 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|