C25H33N3OSi — CID 134970991
[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methanamine (PubChem CID 134970991) has the molecular formula C25H33N3OSi and a molecular weight of 419.65 g/mol. Its IUPAC name is [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methanamine.
| Compound Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methanamine |
|---|---|
| PubChem CID | 134970991 |
| Molecular Formula | C25H33N3OSi |
| Molecular Weight | 419.65 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-methyl-5,6-dihydro-4H-cyclopenta[d]pyrazol-4-yl]methanamine |
| SMILES | Cn1ncc2c1C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC2CN |
| InChI | InChI=1S/C25H33N3OSi/c1-25(2,3)30(21-11-7-5-8-12-21,22-13-9-6-10-14-22)29-18-20-15-19(16-26)23-17-27-28(4)24(20)23/h5-14,17,19-20H,15-16,18,26H2,1-4H3 |
| InChIKey | FKBOICLLBWBCBB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.65 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|