C17H27NO — CID 134971211
(NE)-N-[(5R,6S)-4,4,5-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-cyclopentane]-1'-ylidene]hydroxylamine (PubChem CID 134971211) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (NE)-N-[(5R,6S)-4,4,5-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-cyclopentane]-1'-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[(5R,6S)-4,4,5-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-cyclopentane]-1'-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 134971211 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (NE)-N-[(5R,6S)-4,4,5-trimethylspiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-cyclopentane]-1'-ylidene]hydroxylamine |
| SMILES | C[C@@H]1C2=C(CCCC2(C)C)CC[C@@]12CCC/C2=N\O |
| InChI | InChI=1S/C17H27NO/c1-12-15-13(6-4-9-16(15,2)3)8-11-17(12)10-5-7-14(17)18-19/h12,19H,4-11H2,1-3H3/b18-14+/t12-,17+/m1/s1 |
| InChIKey | XHGBULWWGLBOID-RDQOGUCLSA-N |
| XLogP | 4.92 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|