C14H26O — CID 174474246
methane;1,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol (PubChem CID 174474246) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is methane;1,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol.
| Compound Name | methane;1,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 174474246 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | methane;1,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol |
| SMILES | C.CC1C2=C(CCCC2(C)C)CCC1O |
| InChI | InChI=1S/C13H22O.CH4/c1-9-11(14)7-6-10-5-4-8-13(2,3)12(9)10;/h9,11,14H,4-8H2,1-3H3;1H4 |
| InChIKey | LOMPXAYXLNNUTF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|