C15H25NO — CID 101124373
[(6S)-6-(2,6,6-trimethylcyclohexen-1-yl)-1,2,3,6-tetrahydropyridin-4-yl]methanol (PubChem CID 101124373) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is [(6S)-6-(2,6,6-trimethylcyclohexen-1-yl)-1,2,3,6-tetrahydropyridin-4-yl]methanol.
| Compound Name | [(6S)-6-(2,6,6-trimethylcyclohexen-1-yl)-1,2,3,6-tetrahydropyridin-4-yl]methanol |
|---|---|
| PubChem CID | 101124373 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | [(6S)-6-(2,6,6-trimethylcyclohexen-1-yl)-1,2,3,6-tetrahydropyridin-4-yl]methanol |
| SMILES | CC1=C([C@@H]2C=C(CO)CCN2)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H25NO/c1-11-5-4-7-15(2,3)14(11)13-9-12(10-17)6-8-16-13/h9,13,16-17H,4-8,10H2,1-3H3/t13-/m0/s1 |
| InChIKey | ZCOYMOLWNITYGM-ZDUSSCGKSA-N |
| XLogP | 2.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|