C17H26O — CID 59164860
4,5-dimethyl-6-methylidene-2-(2,6,6-trimethylcyclohexen-1-yl)-2,3-dihydropyran (PubChem CID 59164860) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 4,5-dimethyl-6-methylidene-2-(2,6,6-trimethylcyclohexen-1-yl)-2,3-dihydropyran.
| Compound Name | 4,5-dimethyl-6-methylidene-2-(2,6,6-trimethylcyclohexen-1-yl)-2,3-dihydropyran |
|---|---|
| PubChem CID | 59164860 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 4,5-dimethyl-6-methylidene-2-(2,6,6-trimethylcyclohexen-1-yl)-2,3-dihydropyran |
| SMILES | C=C1OC(C2=C(C)CCCC2(C)C)CC(C)=C1C |
| InChI | InChI=1S/C17H26O/c1-11-8-7-9-17(5,6)16(11)15-10-12(2)13(3)14(4)18-15/h15H,4,7-10H2,1-3,5-6H3 |
| InChIKey | KZOYAILFVFREEP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|